CAS 157866-06-3 appears in our catalog under these names: (3–Bromo–5–formylphenyl)boronic acid, (3-Bromo-5-formylphenyl)boronic acid 95%, (3-Bromo-5-formylphenyl)boronic acid, 95%, (3-bromo-5-formylphenyl)boronic acid, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3-bromo-5-formylphenyl)boronic acid (CAS 157866-06-3) is a chemical compound with the molecular formula C7H6BBrO3 and a molecular weight of 228.84 g/mol. IUPAC name: (3-bromo-5-formylphenyl)boronic acid. InChIKey: GPHPTLRDIAKRGQ-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrO3 |
|---|---|
| Molecular weight | 228.84 g/mol |
| IUPAC name | (3-bromo-5-formylphenyl)boronic acid |
| InChIKey | GPHPTLRDIAKRGQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)C=O)(O)O |
Computed by PubChem (NCBI)