CAS 157913-52-5 appears in our catalog under these names: N,N-Bis(4-bromophenyl)-2,4-dimethylphenylamine, N,N-Bis(4-bromophenyl)-2,4-dimethylbenzenamine, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 5g, 100mg, 250mg.
N,N-bis(4-bromophenyl)-2,4-dimethylaniline (CAS 157913-52-5) is a chemical compound with the molecular formula C20H17Br2N and a molecular weight of 431.2 g/mol. IUPAC name: N,N-bis(4-bromophenyl)-2,4-dimethylaniline. InChIKey: FULWMMKSEOZHND-UHFFFAOYSA-N.
| Molecular formula | C20H17Br2N |
|---|---|
| Molecular weight | 431.2 g/mol |
| IUPAC name | N,N-bis(4-bromophenyl)-2,4-dimethylaniline |
| InChIKey | FULWMMKSEOZHND-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N(C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br)C |
Computed by PubChem (NCBI)