CAS 1579248-79-5 appears in our catalog under these names: 5-Bromo-3-isopropyl-1H-pyrrolo[3,2-b]pyridine, 98%, 98%, 5-Bromo-3-isopropyl-1H-pyrrolo[3,2-b]pyridine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridine (CAS 1579248-79-5) is a chemical compound with the molecular formula C10H11BrN2 and a molecular weight of 239.11 g/mol. IUPAC name: 5-bromo-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridine. InChIKey: PCKJXGQJBIIWBN-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2 |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 5-bromo-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | PCKJXGQJBIIWBN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CNC2=C1N=C(C=C2)Br |
Computed by PubChem (NCBI)