CAS 15797-52-1 appears in our catalog under these names: 1,3,5-Tri(4-hydroxyphenyl)benzene, 98%, 5'-(4-Hydroxyphenyl)-[1,1':3',1''-terphenyl]-4,4''-diol, 97%, 97%, 5'-(4-Hydroxyphenyl)-[1,1':3',1''-terphenyl]-4,4''-diol, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g, 15g, 25g, 100mg.
4-[3,5-bis(4-hydroxyphenyl)phenyl]phenol (CAS 15797-52-1) is a chemical compound with the molecular formula C24H18O3 and a molecular weight of 354.4 g/mol. IUPAC name: 4-[3,5-bis(4-hydroxyphenyl)phenyl]phenol. InChIKey: RQTDWDATSAVLOR-UHFFFAOYSA-N.
| Molecular formula | C24H18O3 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 4-[3,5-bis(4-hydroxyphenyl)phenyl]phenol |
| InChIKey | RQTDWDATSAVLOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C3=CC=C(C=C3)O)C4=CC=C(C=C4)O)O |
Computed by PubChem (NCBI)