CAS 157974-36-2 appears in our catalog under these names: N6-(2-(2-Furanyl)-2-oxoethyl)-L-lysine Dihydrochloride, Furosine dihydrochloride, Furosine (hydrochloride), Furosine hydrochloride, Furosine (hydrochloride), ≥95%, ≥95%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 50mg, 5mg, 1mg, 10mg, 2,5mg, 25mg, 100mg, 5 mg.
(2S)-2-amino-6-[[2-(furan-2-yl)-2-oxoethyl]amino]hexanoic acid;dihydrochloride (CAS 157974-36-2) is a chemical compound with the molecular formula C12H20Cl2N2O4 and a molecular weight of 327.20 g/mol. IUPAC name: (2S)-2-amino-6-[[2-(furan-2-yl)-2-oxoethyl]amino]hexanoic acid;dihydrochloride. InChIKey: HRTZJJIVKJREPV-WWPIYYJJSA-N.
| Molecular formula | C12H20Cl2N2O4 |
|---|---|
| Molecular weight | 327.20 g/mol |
| IUPAC name | (2S)-2-amino-6-[[2-(furan-2-yl)-2-oxoethyl]amino]hexanoic acid;dihydrochloride |
| InChIKey | HRTZJJIVKJREPV-WWPIYYJJSA-N |
| SMILES | C1=COC(=C1)C(=O)CNCCCC[C@@H](C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)