Products 1579991-63-1
CAS 1579991-63-1 appears in our catalog under these names: Chitinase-IN-2, Chitinase-IN-2, 99.38%. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 10 mg, 5 mg, 10mM/1mL, 50 mg, 100 mg.
6-(dimethylamino)-2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]ethyl]benzo[de]isoquinoline-1,3-dione (CAS 1579991-63-1) is a chemical compound with the molecular formula C20H21N5O2S and a molecular weight of 395.5 g/mol. IUPAC name: 6-(dimethylamino)-2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]ethyl]benzo[de]isoquinoline-1,3-dione. InChIKey: MZVBLDCRQKXSHR-UHFFFAOYSA-N.
| Molecular formula | C20H21N5O2S |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | 6-(dimethylamino)-2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]ethyl]benzo[de]isoquinoline-1,3-dione |
| InChIKey | MZVBLDCRQKXSHR-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(S1)CNCCN2C(=O)C3=C4C(=C(C=C3)N(C)C)C=CC=C4C2=O |
Computed by PubChem (NCBI)