CAS 1580-19-4 is the registry number for Perfluoroanthracene. Offered by: TRC. Available pack sizes: 25mg.
1,2,3,4,5,6,7,8,9,10-decafluoroanthracene (CAS 1580-19-4) is a chemical compound with the molecular formula C14F10 and a molecular weight of 358.13 g/mol. IUPAC name: 1,2,3,4,5,6,7,8,9,10-decafluoroanthracene. InChIKey: SYVNSELUWFDWOQ-UHFFFAOYSA-N.
| Molecular formula | C14F10 |
|---|---|
| Molecular weight | 358.13 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8,9,10-decafluoroanthracene |
| InChIKey | SYVNSELUWFDWOQ-UHFFFAOYSA-N |
| SMILES | C12=C(C(=C3C(=C1F)C(=C(C(=C3F)F)F)F)F)C(=C(C(=C2F)F)F)F |
Computed by PubChem (NCBI)