CAS 158009-03-1 appears in our catalog under these names: H–Cys(Trt)–OtBu·HCl, H-L-Cys(Trt)-OtBu*HCl, H-Cys(Trt)-OtBu·HCl 95%, H-Cys(Trt)-OtBu.HCl, 95%, 95%, H-Cys(Trt)-OtBu.HCl, 96%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 100mg, 10g, 100g.
Tert-butyl (2R)-2-amino-3-tritylsulfanylpropanoate;hydrochloride (CAS 158009-03-1) is a chemical compound with the molecular formula C26H30ClNO2S and a molecular weight of 456.0 g/mol. IUPAC name: tert-butyl (2R)-2-amino-3-tritylsulfanylpropanoate;hydrochloride. InChIKey: QPOWWSICTUFREA-BQAIUKQQSA-N.
| Molecular formula | C26H30ClNO2S |
|---|---|
| Molecular weight | 456.0 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-3-tritylsulfanylpropanoate;hydrochloride |
| InChIKey | QPOWWSICTUFREA-BQAIUKQQSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)N.Cl |
Computed by PubChem (NCBI)