CAS 158014-69-8 is the registry number for 4'-(2,4-Dimethylphenyl)-2,2':6',2''-terpyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,4-dimethylphenyl)-2,6-dipyridin-2-ylpyridine (CAS 158014-69-8) is a chemical compound with the molecular formula C23H19N3 and a molecular weight of 337.4 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)-2,6-dipyridin-2-ylpyridine. InChIKey: AOIKEXZOZPOIBL-UHFFFAOYSA-N.
| Molecular formula | C23H19N3 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)-2,6-dipyridin-2-ylpyridine |
| InChIKey | AOIKEXZOZPOIBL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC(=NC(=C2)C3=CC=CC=N3)C4=CC=CC=N4)C |
Computed by PubChem (NCBI)