CAS 158016-09-2 is the registry number for FA-Lys-Leu-OH. Offered by: Creative Peptides, Biosynth. Available pack sizes: on request, 250mg, 100mg, 500mg.
(2S)-2-[[(2S)-6-amino-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]hexanoyl]amino]-4-methylpentanoic acid (CAS 158016-09-2) is a chemical compound with the molecular formula C19H29N3O5 and a molecular weight of 379.5 g/mol. IUPAC name: (2S)-2-[[(2S)-6-amino-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]hexanoyl]amino]-4-methylpentanoic acid. InChIKey: CRXYEFZDLANHTQ-FHQWLQQXSA-N.
| Molecular formula | C19H29N3O5 |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-6-amino-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]hexanoyl]amino]-4-methylpentanoic acid |
| InChIKey | CRXYEFZDLANHTQ-FHQWLQQXSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CCCCN)NC(=O)/C=C/C1=CC=CO1 |
Computed by PubChem (NCBI)