CAS 1580464-64-7 is the registry number for 5-Bromo-2-(pentafluoroethyl)pyridine, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
5-bromo-2-(1,1,2,2,2-pentafluoroethyl)pyridine (CAS 1580464-64-7) is a chemical compound with the molecular formula C7H3BrF5N and a molecular weight of 276.00 g/mol. IUPAC name: 5-bromo-2-(1,1,2,2,2-pentafluoroethyl)pyridine. InChIKey: JBRRBJLDDWCMJK-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF5N |
|---|---|
| Molecular weight | 276.00 g/mol |
| IUPAC name | 5-bromo-2-(1,1,2,2,2-pentafluoroethyl)pyridine |
| InChIKey | JBRRBJLDDWCMJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)