CAS 1580472-97-4 appears in our catalog under these names: Potassium 1,4-dioxaspiro[4.5]dec-7-en-8-yltrifluoroborate, 98%, Potassium {1,4-dioxaspiro(4.5)dec-7-en-8-yl}trifluoroboranuide, POTASSIUM 1,4-DIOXASPIRO[4.5]DEC-7-EN-8-YLTRIFLUOROBORATE, 98%, 98%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 5g, 250mg.
Potassium 1,4-dioxaspiro[4.5]dec-7-en-8-yl(trifluoro)boranuide (CAS 1580472-97-4) is a chemical compound with the molecular formula C8H11BF3KO2 and a molecular weight of 246.08 g/mol. IUPAC name: potassium 1,4-dioxaspiro[4.5]dec-7-en-8-yl(trifluoro)boranuide. InChIKey: QZWUQHLPWVRHTC-UHFFFAOYSA-N.
| Molecular formula | C8H11BF3KO2 |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | potassium 1,4-dioxaspiro[4.5]dec-7-en-8-yl(trifluoro)boranuide |
| InChIKey | QZWUQHLPWVRHTC-UHFFFAOYSA-N |
| SMILES | [B-](C1=CCC2(CC1)OCCO2)(F)(F)F.[K+] |
Computed by PubChem (NCBI)