CAS 158098-50-1 appears in our catalog under these names: 4–Dibenzyl 1–Naphthyl Ketone, 4-Dibenzyl 1-naphthyl ketone, 95%, 4-Dibenzyl 1-Naphthyl Ketone, >98.0%(HPLC), 4-Dibenzyl 1-Naphthyl Ketone, ≥98%, ≥98%, Naphthalen-1-yl(4-phenethylphenyl)methanone, ≥98%. Offered by: GLPBio, Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 200mg, 1g, 250mg.
Naphthalen-1-yl-[4-(2-phenylethyl)phenyl]methanone (CAS 158098-50-1) is a chemical compound with the molecular formula C25H20O and a molecular weight of 336.4 g/mol. IUPAC name: naphthalen-1-yl-[4-(2-phenylethyl)phenyl]methanone. InChIKey: CFQMRXPGNSGVOV-UHFFFAOYSA-N.
| Molecular formula | C25H20O |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | naphthalen-1-yl-[4-(2-phenylethyl)phenyl]methanone |
| InChIKey | CFQMRXPGNSGVOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CC=C(C=C2)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)