CAS 1581758-35-1 is the registry number for 5-(4-bromophenyl)-5-phenyl-5H-dibenzo[b,d]silole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(4-bromophenyl)-5-phenylbenzo[b][1]benzosilole (CAS 1581758-35-1) is a chemical compound with the molecular formula C24H17BrSi and a molecular weight of 413.4 g/mol. IUPAC name: 5-(4-bromophenyl)-5-phenylbenzo[b][1]benzosilole. InChIKey: LSSICEGVAOGOJO-UHFFFAOYSA-N.
| Molecular formula | C24H17BrSi |
|---|---|
| Molecular weight | 413.4 g/mol |
| IUPAC name | 5-(4-bromophenyl)-5-phenylbenzo[b][1]benzosilole |
| InChIKey | LSSICEGVAOGOJO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Si]2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC=C(C=C5)Br |
Computed by PubChem (NCBI)