CAS 15823-71-9 is the registry number for Bis(1,10-phenanthroline)copper(2+), 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(1,10-phenanthroline) (CAS 15823-71-9) is a chemical compound with the molecular formula C24H16CuN4+2 and a molecular weight of 424.0 g/mol. IUPAC name: copper bis(1,10-phenanthroline). InChIKey: YXGZTNUNHBXFAX-UHFFFAOYSA-N.
| Molecular formula | C24H16CuN4+2 |
|---|---|
| Molecular weight | 424.0 g/mol |
| IUPAC name | copper bis(1,10-phenanthroline) |
| InChIKey | YXGZTNUNHBXFAX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.[Cu+2] |
Computed by PubChem (NCBI)