CAS 158234-40-3 is the registry number for AHL-157. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[3-[1-(4-fluorobenzoyl)piperidin-4-yl]phenoxy]-2-methylpropanoic acid (CAS 158234-40-3) is a chemical compound with the molecular formula C22H24FNO4 and a molecular weight of 385.4 g/mol. IUPAC name: 2-[3-[1-(4-fluorobenzoyl)piperidin-4-yl]phenoxy]-2-methylpropanoic acid. InChIKey: XNGGRURGYIXOBY-UHFFFAOYSA-N.
| Molecular formula | C22H24FNO4 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 2-[3-[1-(4-fluorobenzoyl)piperidin-4-yl]phenoxy]-2-methylpropanoic acid |
| InChIKey | XNGGRURGYIXOBY-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=CC(=C1)C2CCN(CC2)C(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)