CAS 15827-10-8 appears in our catalog under these names: Zinc(II) pivalate, Zinc(II) pivalate 98%, Propanoic acid,2,2-dimethyl-, zinc salt (2:1), 97%, 97%, Zinc(II) pivalate, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 500g, 5g, 25g, 1000g, 1kg.
Zinc bis(2,2-dimethylpropanoate) (CAS 15827-10-8) is a chemical compound with the molecular formula C10H18O4Zn and a molecular weight of 267.6 g/mol. IUPAC name: zinc bis(2,2-dimethylpropanoate). InChIKey: HQBBDVUXOOMFQN-UHFFFAOYSA-L.
| Molecular formula | C10H18O4Zn |
|---|---|
| Molecular weight | 267.6 g/mol |
| IUPAC name | zinc bis(2,2-dimethylpropanoate) |
| InChIKey | HQBBDVUXOOMFQN-UHFFFAOYSA-L |
| SMILES | CC(C)(C)C(=O)[O-].CC(C)(C)C(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)