CAS 15827-60-8 appears in our catalog under these names: Diethylenetriaminepenta(methylenephosphonicacid), 50% in water, DTPMP, Diethylenetriaminepenta(methylenephosphonic acid), technical grade 50%, Diethylenetriaminepentakis(methylphosphonic acid) solution, Diethylenetriaminepenta(methylenephosphonic acid), 50% aqueous solution. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 10ml, 25ml, 50ml, 100ml, 2,5l, 500ml, 1kg.
[bis[2-[bis(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid (CAS 15827-60-8) is a chemical compound with the molecular formula C9H28N3O15P5 and a molecular weight of 573.20 g/mol. IUPAC name: [bis[2-[bis(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid. InChIKey: DUYCTCQXNHFCSJ-UHFFFAOYSA-N.
| Molecular formula | C9H28N3O15P5 |
|---|---|
| Molecular weight | 573.20 g/mol |
| IUPAC name | [bis[2-[bis(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid |
| InChIKey | DUYCTCQXNHFCSJ-UHFFFAOYSA-N |
| SMILES | C(CN(CP(=O)(O)O)CP(=O)(O)O)N(CCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O |
Computed by PubChem (NCBI)