Products 15828-08-7
CAS 15828-08-7 appears in our catalog under these names: N-(tert-Butyl)nicotinamide, 95%, N-tert-Butylnicotinamide, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
N-tert-butylpyridine-3-carboxamide (CAS 15828-08-7) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: N-tert-butylpyridine-3-carboxamide. InChIKey: UKLIVFNPJKDBAX-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | N-tert-butylpyridine-3-carboxamide |
| InChIKey | UKLIVFNPJKDBAX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=CN=CC=C1 |
Computed by PubChem (NCBI)