CAS 158303-80-1 is the registry number for D-Serine O-Sulfate Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
(2R)-2-amino-3-sulfooxypropanoic acid;hydrochloride (CAS 158303-80-1) is a chemical compound with the molecular formula C3H8ClNO6S and a molecular weight of 221.62 g/mol. IUPAC name: (2R)-2-amino-3-sulfooxypropanoic acid;hydrochloride. InChIKey: FWEKGSCCQSDZTE-HSHFZTNMSA-N.
| Molecular formula | C3H8ClNO6S |
|---|---|
| Molecular weight | 221.62 g/mol |
| IUPAC name | (2R)-2-amino-3-sulfooxypropanoic acid;hydrochloride |
| InChIKey | FWEKGSCCQSDZTE-HSHFZTNMSA-N |
| SMILES | C([C@H](C(=O)O)N)OS(=O)(=O)O.Cl |
Computed by PubChem (NCBI)