CAS 15832-69-6 is the registry number for 1-(4-Bromophenyl)-1-phenylethanol. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromophenyl)-1-phenylethanol (CAS 15832-69-6) is a chemical compound with the molecular formula C14H13BrO and a molecular weight of 277.16 g/mol. IUPAC name: 1-(4-bromophenyl)-1-phenylethanol. InChIKey: MSJPHIFIUXSDAB-UHFFFAOYSA-N.
| Molecular formula | C14H13BrO |
|---|---|
| Molecular weight | 277.16 g/mol |
| IUPAC name | 1-(4-bromophenyl)-1-phenylethanol |
| InChIKey | MSJPHIFIUXSDAB-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)