Products 1583244-01-2

CAS 1583244-01-2 appears in our catalog under these names: 1-Cyclopentyl-3-mesityl-1H-imidazol-3-ium chloride, 97%, 97%, 1-Cyclopentyl-3-mesityl-1H-imidazol-3-ium chloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-cyclopentyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium chloride (CAS 1583244-01-2) is a chemical compound with the molecular formula C17H23ClN2 and a molecular weight of 290.8 g/mol. IUPAC name: 1-cyclopentyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium chloride. InChIKey: MQSQZJDYWYGMTJ-UHFFFAOYSA-M.

Identity
Molecular formulaC17H23ClN2
Molecular weight290.8 g/mol
IUPAC name1-cyclopentyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium chloride
InChIKeyMQSQZJDYWYGMTJ-UHFFFAOYSA-M
SMILESCC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)C3CCCC3)C.[Cl-]

Computed by PubChem (NCBI)