CAS 158351-86-1 appears in our catalog under these names: 2-(2-Chloro-6-fluorophenyl)ethanimidamide hydrochloride, 95%, 2-(2-Chloro-6-fluorophenyl)ethanimidamide hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 0,5g, 50mg.
2-(2-chloro-6-fluorophenyl)ethanimidamide;hydrochloride (CAS 158351-86-1) is a chemical compound with the molecular formula C8H9Cl2FN2 and a molecular weight of 223.07 g/mol. IUPAC name: 2-(2-chloro-6-fluorophenyl)ethanimidamide;hydrochloride. InChIKey: MCMHJXIGDFWYRV-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2FN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 2-(2-chloro-6-fluorophenyl)ethanimidamide;hydrochloride |
| InChIKey | MCMHJXIGDFWYRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=N)N)F.Cl |
Computed by PubChem (NCBI)