CAS 1583851-63-1 is the registry number for 3-Bromo-4-iodobenzohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-4-iodobenzohydrazide (CAS 1583851-63-1) is a chemical compound with the molecular formula C7H6BrIN2O and a molecular weight of 340.94 g/mol. IUPAC name: 3-bromo-4-iodobenzohydrazide. InChIKey: WZJBJEVKRLECJJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrIN2O |
|---|---|
| Molecular weight | 340.94 g/mol |
| IUPAC name | 3-bromo-4-iodobenzohydrazide |
| InChIKey | WZJBJEVKRLECJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NN)Br)I |
Computed by PubChem (NCBI)