CAS 158389-18-5 is the registry number for Trans-1h,2h-octafluorocyclopentane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Trans-(4S,5S)-1,1,2,2,3,3,4,5-octafluorocyclopentane (CAS 158389-18-5) is a chemical compound with the molecular formula C5H2F8 and a molecular weight of 214.06 g/mol. IUPAC name: trans-(4S,5S)-1,1,2,2,3,3,4,5-octafluorocyclopentane. InChIKey: QVEJLBREDQLBKB-LWMBPPNESA-N.
| Molecular formula | C5H2F8 |
|---|---|
| Molecular weight | 214.06 g/mol |
| IUPAC name | trans-(4S,5S)-1,1,2,2,3,3,4,5-octafluorocyclopentane |
| InChIKey | QVEJLBREDQLBKB-LWMBPPNESA-N |
| SMILES | [C@@H]1([C@@H](C(C(C1(F)F)(F)F)(F)F)F)F |
Computed by PubChem (NCBI)