Products 15845-52-0

CAS 15845-52-0 is the registry number for Phosphoric acid, lead(2+) salt (1:1), ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 50g.

Structural formula: {0} (CAS {1})

Hydrogen phosphate;lead(2+) (CAS 15845-52-0) is a chemical compound with the molecular formula HO4PPb and a molecular weight of 303 g/mol. IUPAC name: hydrogen phosphate;lead(2+). InChIKey: AVVSGTOJTRSKRL-UHFFFAOYSA-L.

Identity
Molecular formulaHO4PPb
Molecular weight303 g/mol
IUPAC namehydrogen phosphate;lead(2+)
InChIKeyAVVSGTOJTRSKRL-UHFFFAOYSA-L
SMILESOP(=O)([O-])[O-].[Pb+2]

Computed by PubChem (NCBI)