Products 158464-67-6
CAS 158464-67-6 is the registry number for 2,3,4-Tris-O-(phenylmethyl)-delta-lactone D-Gluconic Acid. Offered by: TRC. Available pack sizes: 250mg.
(3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-one (CAS 158464-67-6) is a chemical compound with the molecular formula C27H28O6 and a molecular weight of 448.5 g/mol. IUPAC name: (3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-one. InChIKey: XMZVKPUOVUMSAS-FXSWLTOZSA-N.
| Molecular formula | C27H28O6 |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | (3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-one |
| InChIKey | XMZVKPUOVUMSAS-FXSWLTOZSA-N |
| SMILES | C1=CC=C(C=C1)CO[C@@H]2[C@H](OC(=O)[C@@H]([C@H]2OCC3=CC=CC=C3)OCC4=CC=CC=C4)CO |
Computed by PubChem (NCBI)