CAS 158499-69-5 is the registry number for 4-(4-Chlorophenyl)-2-(quinolin-4-yl)-4,5-dihydrooxazole, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-chlorophenyl)-2-quinolin-4-yl-4,5-dihydro-1,3-oxazole (CAS 158499-69-5) is a chemical compound with the molecular formula C18H13ClN2O and a molecular weight of 308.8 g/mol. IUPAC name: 4-(4-chlorophenyl)-2-quinolin-4-yl-4,5-dihydro-1,3-oxazole. InChIKey: KQVFSCNQXVYISP-UHFFFAOYSA-N.
| Molecular formula | C18H13ClN2O |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2-quinolin-4-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | KQVFSCNQXVYISP-UHFFFAOYSA-N |
| SMILES | C1C(N=C(O1)C2=CC=NC3=CC=CC=C23)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)