Products 1585095-27-7
CAS 1585095-27-7 is the registry number for (S)-2-Amino-3-methyl-N-(5-methylpyridin-2-yl)butanamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-methyl-N-(5-methyl-2-pyridinyl)butanamide;hydrochloride (CAS 1585095-27-7) is a chemical compound with the molecular formula C11H18ClN3O and a molecular weight of 243.73 g/mol. IUPAC name: (2S)-2-amino-3-methyl-N-(5-methyl-2-pyridinyl)butanamide;hydrochloride. InChIKey: KVSFVHGWFOHYQC-PPHPATTJSA-N.
| Molecular formula | C11H18ClN3O |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | (2S)-2-amino-3-methyl-N-(5-methyl-2-pyridinyl)butanamide;hydrochloride |
| InChIKey | KVSFVHGWFOHYQC-PPHPATTJSA-N |
| SMILES | CC1=CN=C(C=C1)NC(=O)[C@H](C(C)C)N.Cl |
Computed by PubChem (NCBI)