Products 1585213-98-4
CAS 1585213-98-4 is the registry number for Inz-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 2-[3-[2-fluoro-5-(trifluoromethyl)phenyl]-7-methylindazol-1-yl]acetate (CAS 1585213-98-4) is a chemical compound with the molecular formula C18H14F4N2O2 and a molecular weight of 366.3 g/mol. IUPAC name: methyl 2-[3-[2-fluoro-5-(trifluoromethyl)phenyl]-7-methylindazol-1-yl]acetate. InChIKey: HNOVBJYCGAYMLG-UHFFFAOYSA-N.
| Molecular formula | C18H14F4N2O2 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | methyl 2-[3-[2-fluoro-5-(trifluoromethyl)phenyl]-7-methylindazol-1-yl]acetate |
| InChIKey | HNOVBJYCGAYMLG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=NN2CC(=O)OC)C3=C(C=CC(=C3)C(F)(F)F)F |
Computed by PubChem (NCBI)