CAS 15862-31-4 appears in our catalog under these names: 3–bromo–5–nitropyridin–2–amine, 3-Bromo-5-nitropyridin-2-amine 97%, 2-Amino-3-bromo-5-nitropyridine, 97%, 97%, 2-Amino-3-bromo-5-nitropyridine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 1000g, 1g, 5g, 10g, 25g, 500g, 50g.
3-bromo-5-nitropyridin-2-amine (CAS 15862-31-4) is a chemical compound with the molecular formula C5H4BrN3O2 and a molecular weight of 218.01 g/mol. IUPAC name: 3-bromo-5-nitropyridin-2-amine. InChIKey: OFXNHXMPRZDIDM-UHFFFAOYSA-N.
| Molecular formula | C5H4BrN3O2 |
|---|---|
| Molecular weight | 218.01 g/mol |
| IUPAC name | 3-bromo-5-nitropyridin-2-amine |
| InChIKey | OFXNHXMPRZDIDM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)