CAS 158629-13-1 appears in our catalog under these names: N,O-Diacetyllamivudine, >95% (HPLC), N,O-Diacetyllamivudine. Offered by: TRC, Mikromol. Available pack sizes: 250mg, 500mg, 50mg, 25mg.
[(2R,5S)-5-(4-acetamido-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl acetate (CAS 158629-13-1) is a chemical compound with the molecular formula C12H15N3O5S and a molecular weight of 313.33 g/mol. IUPAC name: [(2R,5S)-5-(4-acetamido-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl acetate. InChIKey: WTTHNEBZNGXQNW-WDEREUQCSA-N.
| Molecular formula | C12H15N3O5S |
|---|---|
| Molecular weight | 313.33 g/mol |
| IUPAC name | [(2R,5S)-5-(4-acetamido-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl acetate |
| InChIKey | WTTHNEBZNGXQNW-WDEREUQCSA-N |
| SMILES | CC(=O)NC1=NC(=O)N(C=C1)[C@@H]2CS[C@@H](O2)COC(=O)C |
Computed by PubChem (NCBI)