CAS 1586574-46-0 is the registry number for (5-Bromopyridin-2-yl)(1,4-diazepan-1-yl)methanone hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-bromo-2-pyridinyl)-(1,4-diazepan-1-yl)methanone;hydrochloride (CAS 1586574-46-0) is a chemical compound with the molecular formula C11H15BrClN3O and a molecular weight of 320.61 g/mol. IUPAC name: (5-bromo-2-pyridinyl)-(1,4-diazepan-1-yl)methanone;hydrochloride. InChIKey: FWCWTPAGYKIEOX-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClN3O |
|---|---|
| Molecular weight | 320.61 g/mol |
| IUPAC name | (5-bromo-2-pyridinyl)-(1,4-diazepan-1-yl)methanone;hydrochloride |
| InChIKey | FWCWTPAGYKIEOX-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C(=O)C2=NC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)