CAS 158690-51-8 is the registry number for Phenanthro(1,10-cd)(1,2)dithiole. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
10,11-dithiatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaene (CAS 158690-51-8) is a chemical compound with the molecular formula C14H8S2 and a molecular weight of 240.3 g/mol. IUPAC name: 10,11-dithiatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaene. InChIKey: XVNIHMCQNLMCTE-UHFFFAOYSA-N.
| Molecular formula | C14H8S2 |
|---|---|
| Molecular weight | 240.3 g/mol |
| IUPAC name | 10,11-dithiatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaene |
| InChIKey | XVNIHMCQNLMCTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C3=C4C(=CC=C3)SSC4=CC2=C1 |
Computed by PubChem (NCBI)