CAS 158693-01-7 appears in our catalog under these names: Entacapone Impurity 10, Entacapone Amide. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 250mg.
(E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enamide (CAS 158693-01-7) is a chemical compound with the molecular formula C10H7N3O5 and a molecular weight of 249.18 g/mol. IUPAC name: (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enamide. InChIKey: IZXCSWDOAKESAA-LZCJLJQNSA-N.
| Molecular formula | C10H7N3O5 |
|---|---|
| Molecular weight | 249.18 g/mol |
| IUPAC name | (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enamide |
| InChIKey | IZXCSWDOAKESAA-LZCJLJQNSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)O)/C=C(\C#N)/C(=O)N |
Computed by PubChem (NCBI)