CAS 1587-41-3 is the registry number for Dichlorodinitromethane. Offered by: TRC. Available pack sizes: 50mg.
Dichloro(dinitro)methane (CAS 1587-41-3) is a chemical compound with the molecular formula CCl2N2O4 and a molecular weight of 174.92 g/mol. IUPAC name: dichloro(dinitro)methane. InChIKey: VLWDJCZBZPKOGX-UHFFFAOYSA-N.
| Molecular formula | CCl2N2O4 |
|---|---|
| Molecular weight | 174.92 g/mol |
| IUPAC name | dichloro(dinitro)methane |
| InChIKey | VLWDJCZBZPKOGX-UHFFFAOYSA-N |
| SMILES | C([N+](=O)[O-])([N+](=O)[O-])(Cl)Cl |
Computed by PubChem (NCBI)