Products 158706-42-4
CAS 158706-42-4 is the registry number for ethyl (2R,5S)-5-phenylpyrrolidine-2-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl (2R,5S)-5-phenylpyrrolidine-2-carboxylate (CAS 158706-42-4) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: ethyl (2R,5S)-5-phenylpyrrolidine-2-carboxylate. InChIKey: BJOUEZQMVVKCPC-NWDGAFQWSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | ethyl (2R,5S)-5-phenylpyrrolidine-2-carboxylate |
| InChIKey | BJOUEZQMVVKCPC-NWDGAFQWSA-N |
| SMILES | CCOC(=O)[C@H]1CC[C@H](N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)