Products 158739-04-9
CAS 158739-04-9 is the registry number for Fmoc-Leu-Val-OH, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]amino]-3-methylbutanoic acid (CAS 158739-04-9) is a chemical compound with the molecular formula C26H32N2O5 and a molecular weight of 452.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]amino]-3-methylbutanoic acid. InChIKey: FMNPQVPFXQUTKM-GOTSBHOMSA-N.
| Molecular formula | C26H32N2O5 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]amino]-3-methylbutanoic acid |
| InChIKey | FMNPQVPFXQUTKM-GOTSBHOMSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](C(C)C)C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)