CAS 15875-54-4 is the registry number for 2-((4-Chlorophenyl)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 25g, 10g.
2-[(4-chlorophenyl)methylidene]indene-1,3-dione (CAS 15875-54-4) is a chemical compound with the molecular formula C16H9ClO2 and a molecular weight of 268.69 g/mol. IUPAC name: 2-[(4-chlorophenyl)methylidene]indene-1,3-dione. InChIKey: DPSNBOGJIUODEX-UHFFFAOYSA-N.
| Molecular formula | C16H9ClO2 |
|---|---|
| Molecular weight | 268.69 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)methylidene]indene-1,3-dione |
| InChIKey | DPSNBOGJIUODEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CC3=CC=C(C=C3)Cl)C2=O |
Computed by PubChem (NCBI)