CAS 158751-64-5 appears in our catalog under these names: Clamikalant, 95%, Clamikalant. Offered by: Combi-blocks, Biosynth, MedChemExpress. Available pack sizes: 1g, 250mg, 500mg, Get quote.
5-chloro-2-methoxy-N-[2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]ethyl]benzamide (CAS 158751-64-5) is a chemical compound with the molecular formula C19H22ClN3O5S2 and a molecular weight of 472.0 g/mol. IUPAC name: 5-chloro-2-methoxy-N-[2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]ethyl]benzamide. InChIKey: VXTKXGKPBOLHRY-UHFFFAOYSA-N.
| Molecular formula | C19H22ClN3O5S2 |
|---|---|
| Molecular weight | 472.0 g/mol |
| IUPAC name | 5-chloro-2-methoxy-N-[2-[4-methoxy-3-(methylcarbamothioylsulfamoyl)phenyl]ethyl]benzamide |
| InChIKey | VXTKXGKPBOLHRY-UHFFFAOYSA-N |
| SMILES | CNC(=S)NS(=O)(=O)C1=C(C=CC(=C1)CCNC(=O)C2=C(C=CC(=C2)Cl)OC)OC |
Computed by PubChem (NCBI)