Products 1587638-01-4
CAS 1587638-01-4 is the registry number for Tolvaptan Impurity 3 (DM-4104). Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-chloro-2-(1,4-dihydroxybutyl)phenyl]-2-methyl-4-[(2-methylbenzoyl)amino]benzamide (CAS 1587638-01-4) is a chemical compound with the molecular formula C26H27ClN2O4 and a molecular weight of 467.0 g/mol. IUPAC name: N-[4-chloro-2-(1,4-dihydroxybutyl)phenyl]-2-methyl-4-[(2-methylbenzoyl)amino]benzamide. InChIKey: REAJDTVMDVXFQN-UHFFFAOYSA-N.
| Molecular formula | C26H27ClN2O4 |
|---|---|
| Molecular weight | 467.0 g/mol |
| IUPAC name | N-[4-chloro-2-(1,4-dihydroxybutyl)phenyl]-2-methyl-4-[(2-methylbenzoyl)amino]benzamide |
| InChIKey | REAJDTVMDVXFQN-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)C(=O)NC3=C(C=C(C=C3)Cl)C(CCCO)O)C |
Computed by PubChem (NCBI)
Synonyms:
Tolvaptan metabolite DM-4104