Products 1587638-02-5
CAS 1587638-02-5 is the registry number for Tolvaptan Impurity 4 (DM-4105). Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-chloro-2-(4-hydroxybutanoyl)phenyl]-2-methyl-4-[(2-methylbenzoyl)amino]benzamide (CAS 1587638-02-5) is a chemical compound with the molecular formula C26H25ClN2O4 and a molecular weight of 464.9 g/mol. IUPAC name: N-[4-chloro-2-(4-hydroxybutanoyl)phenyl]-2-methyl-4-[(2-methylbenzoyl)amino]benzamide. InChIKey: QWZRSISDUYQRCE-UHFFFAOYSA-N.
| Molecular formula | C26H25ClN2O4 |
|---|---|
| Molecular weight | 464.9 g/mol |
| IUPAC name | N-[4-chloro-2-(4-hydroxybutanoyl)phenyl]-2-methyl-4-[(2-methylbenzoyl)amino]benzamide |
| InChIKey | QWZRSISDUYQRCE-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)C(=O)NC3=C(C=C(C=C3)Cl)C(=O)CCCO)C |
Computed by PubChem (NCBI)
Synonyms:
Tolvaptan metabolite DM-4105