CAS 1588440-96-3 appears in our catalog under these names: tert-Butyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate oxalate, 95%, tert–Butyl 4–(aminomethyl)–4–hydroxypiperidine–1–carboxylate oxalate, tert-Butyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate oxalate, tert-Butyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate oxalate, 95%, 95%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100g, 10g, 100mg, 25g.
Tert-butyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate;oxalic acid (CAS 1588440-96-3) is a chemical compound with the molecular formula C13H24N2O7 and a molecular weight of 320.34 g/mol. IUPAC name: tert-butyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate;oxalic acid. InChIKey: HKSRFBZYCJTGCW-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O7 |
|---|---|
| Molecular weight | 320.34 g/mol |
| IUPAC name | tert-butyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate;oxalic acid |
| InChIKey | HKSRFBZYCJTGCW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CN)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)