CAS 1588441-12-6 appears in our catalog under these names: 4-(Trifluoromethoxy)-2-(trifluoromethyl)aniline hydrochloride, 95%, 95%, 4-(Trifluoromethoxy)-2-(trifluoromethyl)aniline hydrochloride, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(trifluoromethoxy)-2-(trifluoromethyl)aniline;hydrochloride (CAS 1588441-12-6) is a chemical compound with the molecular formula C8H6ClF6NO and a molecular weight of 281.58 g/mol. IUPAC name: 4-(trifluoromethoxy)-2-(trifluoromethyl)aniline;hydrochloride. InChIKey: OOYFYPCKMNFFTA-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF6NO |
|---|---|
| Molecular weight | 281.58 g/mol |
| IUPAC name | 4-(trifluoromethoxy)-2-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | OOYFYPCKMNFFTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)