CAS 1588441-24-0 is the registry number for 2-Amino-5-chloropyrimidine-4-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 10g, 5g, 1g.
2-amino-5-chloropyrimidine-4-carboxylic acid;hydrochloride (CAS 1588441-24-0) is a chemical compound with the molecular formula C5H5Cl2N3O2 and a molecular weight of 210.02 g/mol. IUPAC name: 2-amino-5-chloropyrimidine-4-carboxylic acid;hydrochloride. InChIKey: ZHXGZTTYUZPTLL-UHFFFAOYSA-N.
| Molecular formula | C5H5Cl2N3O2 |
|---|---|
| Molecular weight | 210.02 g/mol |
| IUPAC name | 2-amino-5-chloropyrimidine-4-carboxylic acid;hydrochloride |
| InChIKey | ZHXGZTTYUZPTLL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)N)C(=O)O)Cl.Cl |
Computed by PubChem (NCBI)