CAS 158876-70-1 is the registry number for 2–(2–bromopyridin–4–yl)–1–(4–fluorophenyl)ethanone. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-(2-bromo-4-pyridinyl)-1-(4-fluorophenyl)ethanone (CAS 158876-70-1) is a chemical compound with the molecular formula C13H9BrFNO and a molecular weight of 294.12 g/mol. IUPAC name: 2-(2-bromo-4-pyridinyl)-1-(4-fluorophenyl)ethanone. InChIKey: XBWVIFPZBMULPB-UHFFFAOYSA-N.
| Molecular formula | C13H9BrFNO |
|---|---|
| Molecular weight | 294.12 g/mol |
| IUPAC name | 2-(2-bromo-4-pyridinyl)-1-(4-fluorophenyl)ethanone |
| InChIKey | XBWVIFPZBMULPB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC2=CC(=NC=C2)Br)F |
Computed by PubChem (NCBI)