CAS 158932-00-4 appears in our catalog under these names: Boc–D–Tryptophanol, N(^a)-Boc-D-tryptophanol, 98% , Boc-D-Trp-OL 97%, Boc-D-Tryptophanol, 98%, 98%, Boc-D-Tryptophanol, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 250mg.
Tert-butyl N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]carbamate (CAS 158932-00-4) is a chemical compound with the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. IUPAC name: tert-butyl N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]carbamate. InChIKey: JEFQUFUAEKORKL-GFCCVEGCSA-N.
| Molecular formula | C16H22N2O3 |
|---|---|
| Molecular weight | 290.36 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]carbamate |
| InChIKey | JEFQUFUAEKORKL-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CNC2=CC=CC=C21)CO |
Computed by PubChem (NCBI)