CAS 158943-22-7 appears in our catalog under these names: 1-(3-Chlorophenyl)cyclobutanamine, 98%, 1-(3-Chlorophenyl)cyclobutan-1-amine hydrochloride, 90%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 250mg.
1-(3-chlorophenyl)cyclobutan-1-amine (CAS 158943-22-7) is a chemical compound with the molecular formula C10H12ClN and a molecular weight of 181.66 g/mol. IUPAC name: 1-(3-chlorophenyl)cyclobutan-1-amine. InChIKey: ZSZAJZSGPJCTML-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | 1-(3-chlorophenyl)cyclobutan-1-amine |
| InChIKey | ZSZAJZSGPJCTML-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=CC=C2)Cl)N |
Computed by PubChem (NCBI)