CAS 1589492-99-8 is the registry number for N-(4-(N-(2-Aminoethyl)sulfamoyl)phenyl)acetamide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-(2-aminoethylsulfamoyl)phenyl]acetamide;hydrochloride (CAS 1589492-99-8) is a chemical compound with the molecular formula C10H16ClN3O3S and a molecular weight of 293.77 g/mol. IUPAC name: N-[4-(2-aminoethylsulfamoyl)phenyl]acetamide;hydrochloride. InChIKey: VWIFSUGPRQQUJN-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN3O3S |
|---|---|
| Molecular weight | 293.77 g/mol |
| IUPAC name | N-[4-(2-aminoethylsulfamoyl)phenyl]acetamide;hydrochloride |
| InChIKey | VWIFSUGPRQQUJN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NCCN.Cl |
Computed by PubChem (NCBI)