CAS 159-62-6 appears in our catalog under these names: Spiro(fluorene–9,9'–xanthene), Spiro[fluorene-9,9'-xanthene] 97%, Spiro[fluorene-9,9'-xanthene], 97%, 97%, Spiro[fluorene-9,9'-xanthene], 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
Spiro[fluorene-9,9'-xanthene] (CAS 159-62-6) is a chemical compound with the molecular formula C25H16O and a molecular weight of 332.4 g/mol. IUPAC name: spiro[fluorene-9,9'-xanthene]. InChIKey: QQNLHOMPVNTETJ-UHFFFAOYSA-N.
| Molecular formula | C25H16O |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | spiro[fluorene-9,9'-xanthene] |
| InChIKey | QQNLHOMPVNTETJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C24C5=CC=CC=C5OC6=CC=CC=C46 |
Computed by PubChem (NCBI)